EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O6 |
| Net Charge | 0 |
| Average Mass | 294.303 |
| Monoisotopic Mass | 294.11034 |
| SMILES | COC(=O)c1c(O)c2c(c(C)c1OC)C(C)C(C)OC2=O |
| InChI | InChI=1S/C15H18O6/c1-6-8(3)21-15(18)10-9(6)7(2)13(19-4)11(12(10)16)14(17)20-5/h6,8,16H,1-5H3 |
| InChIKey | ZBHZUHLBPGCZPP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-dihydro-6-methoxy-8-hydroxy-3,4,5-trimethyl-isocoumarin-7-carboxylic acid methyl ester (CHEBI:204982) is a phthalate ester (CHEBI:35484) |
| IUPAC Name |
|---|
| methyl 8-hydroxy-6-methoxy-3,4,5-trimethyl-1-oxo-3,4-dihydroisochromene-7-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 26949186 | ChemSpider |