EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10O6 |
| Net Charge | 0 |
| Average Mass | 274.228 |
| Monoisotopic Mass | 274.04774 |
| SMILES | Cc1cc(=O)c2c(o1)-c1c(cc(O)cc1C(=O)O)OC2 |
| InChI | InChI=1S/C14H10O6/c1-6-2-10(16)9-5-19-11-4-7(15)3-8(14(17)18)12(11)13(9)20-6/h2-4,15H,5H2,1H3,(H,17,18) |
| InChIKey | ZDZPERPGSFSQEA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Myxotrichumspecies (ncbitaxon:1921597) | - | DOI (10.1016/j.phytol.2013.08.011) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Myxotrichin D (CHEBI:204948) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 8-hydroxy-2-methyl-4-oxo-5H-pyrano[3,2-c]chromene-10-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 78435638 | ChemSpider |