EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H33N5O12 |
| Net Charge | 0 |
| Average Mass | 571.540 |
| Monoisotopic Mass | 571.21257 |
| SMILES | CC(OC(=O)[C@@H](N)CCCN(O)C=O)[C@H](NC(=O)c1cccc(O)c1O)C(=O)N[C@@H](CCCN(O)C=O)C(=O)O |
| InChI | InChI=1S/C23H33N5O12/c1-13(40-23(37)15(24)6-3-9-27(38)11-29)18(26-20(33)14-5-2-8-17(31)19(14)32)21(34)25-16(22(35)36)7-4-10-28(39)12-30/h2,5,8,11-13,15-16,18,31-32,38-39H,3-4,6-7,9-10,24H2,1H3,(H,25,34)(H,26,33)(H,35,36)/t13?,15-,16-,18-/m0/s1 |
| InChIKey | JFONHXNWLVUYOJ-XGSMPJOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rhodococcus jostii RHA1 (ncbitaxon:101510) | - | PubMed (21381663) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Rhodochelin (CHEBI:204946) is a depsipeptide (CHEBI:23643) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S)-3-[(2S)-2-amino-5-[ormyl(hydroxy)amino]pentanoyl]oxy-2-[(2,3-dihydroxybenzoyl)amino]butanoyl]amino]-5-[ormyl(hydroxy)amino]pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 28288673 | ChemSpider |