EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H44O5 |
| Net Charge | 0 |
| Average Mass | 436.633 |
| Monoisotopic Mass | 436.31887 |
| SMILES | COC1(OC)CC[C@@]2(C)C(CCC3C2C[C@H](O)[C@@]2(C)C3CCC2[C@H](C)CCC(=O)O)C1 |
| InChI | InChI=1S/C26H44O5/c1-16(6-11-23(28)29)19-9-10-20-18-8-7-17-15-26(30-4,31-5)13-12-24(17,2)21(18)14-22(27)25(19,20)3/h16-22,27H,6-15H2,1-5H3,(H,28,29)/t16-,17?,18?,19?,20?,21?,22+,24+,25-/m1/s1 |
| InChIKey | PXVDLLGKBOZWKD-YEUZUKKDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Psychrobacterspecies (ncbitaxon:56811) | - | PubMed (19557363) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Dimethoxy-12alpha-hydroxycholanic acid (CHEBI:204922) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (4R)-4-[(10S,12S,13R)-12-hydroxy-3,3-dimethoxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78445516 | ChemSpider |