EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H64N6O6 |
| Net Charge | 0 |
| Average Mass | 700.966 |
| Monoisotopic Mass | 700.48873 |
| SMILES | CC[C@H](C)[C@@H](C(=O)NC)N(C)C(=O)[C@@H](NC(=O)[C@H](C(C)C)N(C)C(=O)[C@H](C(C)C)N(C)C(=O)[C@H](C(C)C)N(C)C(=O)c1ccccc1)C(C)C |
| InChI | InChI=1S/C38H64N6O6/c1-16-26(10)32(33(45)39-11)44(15)36(48)28(22(2)3)40-34(46)29(23(4)5)41(12)37(49)31(25(8)9)43(14)38(50)30(24(6)7)42(13)35(47)27-20-18-17-19-21-27/h17-26,28-32H,16H2,1-15H3,(H,39,45)(H,40,46)/t26-,28-,29-,30-,31-,32-/m0/s1 |
| InChIKey | CNRMKFPXKKVJQX-LQPYQXOBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pterulaspecies (ncbitaxon:2040936) | - | PubMed (17067148) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pterulamide V (CHEBI:204921) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| N-methyl-N-[(2S)-3-methyl-1-[methyl-[(2S)-3-methyl-1-[methyl-[(2S)-3-methyl-1-[[(2S)-3-methyl-1-[methyl-[(2S,3S)-3-methyl-1-(methylamino)-1-oxopentan-2-yl]amino]-1-oxobutan-2-yl]amino]-1-oxobutan-2-yl]amino]-1-oxobutan-2-yl]amino]-1-oxobutan-2-yl]benzamide |
| Manual Xrefs | Databases |
|---|---|
| 17250099 | ChemSpider |