EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11NO4 |
| Net Charge | 0 |
| Average Mass | 209.201 |
| Monoisotopic Mass | 209.06881 |
| SMILES | C[C@H](O)C(=O)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C10H11NO4/c1-6(12)9(13)11-8-5-3-2-4-7(8)10(14)15/h2-6,12H,1H3,(H,11,13)(H,14,15)/t6-/m0/s1 |
| InChIKey | NPBSOOGJABVFSN-LURJTMIESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium chrysogenum (ncbitaxon:5076) | - | DOI (10.1007/s10600-014-0971-3) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(2-hydroxypropanamido) benzoic acid (CHEBI:204888) is a amidobenzoic acid (CHEBI:48470) |
| IUPAC Name |
|---|
| 2-(2-hydroxypropanoylamino)benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 32674610 | ChemSpider |