EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H57N3O9 |
| Net Charge | 0 |
| Average Mass | 675.864 |
| Monoisotopic Mass | 675.40948 |
| SMILES | C=C[C@@H](C)[C@H]1C(=O)O[C@H](C(C)C)C(=O)N(C)[C@H]([C@@H](C)C=C)C(=O)O[C@H](C(C)C)C(=O)N(C)[C@@H]([C@H](C)C=C)C(=O)O[C@H](C(C)C)C(=O)N1C |
| InChI | InChI=1S/C36H57N3O9/c1-16-22(10)25-34(43)46-29(20(6)7)32(41)38(14)27(24(12)18-3)36(45)48-30(21(8)9)33(42)39(15)26(23(11)17-2)35(44)47-28(19(4)5)31(40)37(25)13/h16-30H,1-3H2,4-15H3/t22-,23-,24+,25+,26+,27-,28-,29-,30-/m1/s1 |
| InChIKey | UDWLQTHZFSAAHA-KNMMEEQTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium (ncbitaxon:5506) | - | PubMed (25315756) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Enniatin Q (CHEBI:204877) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (3R,6R,9S,12R,15S,18R)-9,15-bis[(2R)-but-3-en-2-yl]-3-[(2S)-but-3-en-2-yl]-4,10,16-trimethyl-6,12,18-tri(propan-2-yl)-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone |