EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H21N5O9 |
| Net Charge | 0 |
| Average Mass | 403.348 |
| Monoisotopic Mass | 403.13393 |
| SMILES | C[C@H](N)C(=O)N[C@@H](CCO)C(=O)N[C@@H](CC(=O)Oc1nnc(=O)c1O)C(=O)O |
| InChI | InChI=1S/C14H21N5O9/c1-5(15)10(23)16-6(2-3-20)11(24)17-7(14(26)27)4-8(21)28-13-9(22)12(25)18-19-13/h5-7,20,22H,2-4,15H2,1H3,(H,16,23)(H,17,24)(H,26,27)(H2,18,19,25)/t5-,6-,7-/m0/s1 |
| InChIKey | OSMOXHWFOQKIKE-ACZMJKKPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Burkholderia glumae (ncbitaxon:337) | - | PubMed (18834606) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(L-alanyl-L-homoserinyl-L-aspartyl-betacarboxy)-4-hydroxy-5-oxopyrazole (CHEBI:204843) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-4-hydroxybutanoyl]amino]-4-[(4-hydroxy-5-oxo-1,2-dihydropyrazol-3-yl)oxy]-4-oxobutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78437203 | ChemSpider |