EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12N2O5S |
| Net Charge | 0 |
| Average Mass | 260.271 |
| Monoisotopic Mass | 260.04669 |
| SMILES | O=c1nc(=S)ccn1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C9H12N2O5S/c12-3-4-6(13)7(14)8(16-4)11-2-1-5(17)10-9(11)15/h1-2,4,6-8,12-14H,3H2,(H,10,15,17)/t4-,6-,7-,8-/m1/s1 |
| InChIKey | ZLOIGESWDJYCTF-XVFCMESISA-N |
| Roles Classification |
|---|
| Biological Roles: | affinity label An enzyme inhibitor, generally irreversible, that is similar in structure to a particular substrate for a specific enzyme. antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-thiouridine (CHEBI:20480) has role affinity label (CHEBI:60788) |
| 4-thiouridine (CHEBI:20480) has role antimetabolite (CHEBI:35221) |
| 4-thiouridine (CHEBI:20480) is a nucleoside analogue (CHEBI:60783) |
| 4-thiouridine (CHEBI:20480) is a thiouridine (CHEBI:26978) |
| IUPAC Name |
|---|
| 1-(β-D-ribofuranosyl)-4-thioxo-3,4-dihydropyrimidin-2(1H)-one |
| Synonyms | Source |
|---|---|
| thiouridine | ChemIDplus |
| 1-β-D-ribofuranosyl-4-thiouracil | ChEBI |
| s4u | ChEBI |
| UniProt Name | Source |
|---|---|
| 4-thiouridine | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:28750 | Reaxys |
| CAS:13957-31-8 | ChemIDplus |