EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H46O4 |
| Net Charge | 0 |
| Average Mass | 482.705 |
| Monoisotopic Mass | 482.33961 |
| SMILES | CC1=C(C)C2(C[C@@H](C)[C@H]3[C@@H](C[C@@]4(C)C5=C(CC[C@]34C)[C@@]3(C)CC[C@@H](O)C(C)(C)C3CC5)O2)OC1=O |
| InChI | InChI=1S/C31H46O4/c1-17-15-31(19(3)18(2)26(33)35-31)34-22-16-30(8)21-9-10-23-27(4,5)24(32)12-13-28(23,6)20(21)11-14-29(30,7)25(17)22/h17,22-25,32H,9-16H2,1-8H3/t17-,22-,23?,24-,25+,28-,29-,30+,31?/m1/s1 |
| InChIKey | YJWGOAFXHNYHNJ-PUVHEFRBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hexagonia apiaria (ncbitaxon:252826) | - | PubMed (26575215) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hexagonin B (CHEBI:204798) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| (2R,4R,8R,9R,10R,14S,17R)-17-hydroxy-2,3',4',8,10,14,18,18-octamethylspiro[5-oxapentacyclo[11.8.0.02,10.04,9.014,19]henicos-1(13)-ene-6,5'-uran]-2'-one |
| Manual Xrefs | Databases |
|---|---|
| 78441017 | ChemSpider |