EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H15NO5 |
| Net Charge | 0 |
| Average Mass | 301.298 |
| Monoisotopic Mass | 301.09502 |
| SMILES | C[C@H]1O[C@H](CC(N)=O)CC2=C1C(=O)c1c(O)cccc1C2=O |
| InChI | InChI=1S/C16H15NO5/c1-7-13-10(5-8(22-7)6-12(17)19)15(20)9-3-2-4-11(18)14(9)16(13)21/h2-4,7-8,18H,5-6H2,1H3,(H2,17,19)/t7-,8+/m1/s1 |
| InChIKey | VENLWOFOMJQPFA-SFYZADRCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces rosa (ncbitaxon:68265) | - | PubMed (1206004) |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nanaomycin C (CHEBI:204782) is a benzoisochromanequinone (CHEBI:48129) |
| IUPAC Name |
|---|
| 2-[(1R,3S)-9-hydroxy-1-methyl-5,10-dioxo-3,4-dihydro-1H-benzo[g]isochromen-3-yl]acetamide |
| Manual Xrefs | Databases |
|---|---|
| 2342098 | ChemSpider |