EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H30O6 |
| Net Charge | 0 |
| Average Mass | 534.608 |
| Monoisotopic Mass | 534.20424 |
| SMILES | O=C1O[C@@]23[C@H](c4ccccc4)C[C@@H](O)[C@@](O)(c4ccccc4)[C@]2(O)[C@]1(Cc1ccccc1)O[C@H]3c1ccccc1 |
| InChI | InChI=1S/C34H30O6/c35-28-21-27(24-15-7-2-8-16-24)33-29(25-17-9-3-10-18-25)39-31(30(36)40-33,22-23-13-5-1-6-14-23)34(33,38)32(28,37)26-19-11-4-12-20-26/h1-20,27-29,35,37-38H,21-22H2/t27-,28+,29-,31+,32-,33+,34+/m0/s1 |
| InChIKey | ZRTHDXCISSSDQB-JQQVBRSKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kyrtuthrix (ncbitaxon:1906669) | - | PubMed (9548830) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Maculalactone J (CHEBI:204777) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| (1R,2S,4R,5S,6R,7S,9S)-7-benzyl-4,5,6-trihydroxy-2,5,9-triphenyl-8,10-dioxatricyclo[5.2.2.01,6]undecan-11-one |