EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22N2O2 |
| Net Charge | 0 |
| Average Mass | 286.375 |
| Monoisotopic Mass | 286.16813 |
| SMILES | CN[C@@H](Cc1cnc2cccc(CC=C(C)C)c12)C(=O)O |
| InChI | InChI=1S/C17H22N2O2/c1-11(2)7-8-12-5-4-6-14-16(12)13(10-19-14)9-15(18-3)17(20)21/h4-7,10,15,18-19H,8-9H2,1-3H3,(H,20,21)/t15-/m0/s1 |
| InChIKey | QQMWUGXCTSAHLX-HNNXBMFYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Claviceps purpurea (ncbitaxon:5111) | - | DOI (10.1016/s0040-4039(00)91168-7) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methyl-4-dimethylallyltryptophan (CHEBI:204735) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| 2-(methylamino)-3-[4-(3-methylbut-2-enyl)-1H-indol-3-yl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 23510998 | ChemSpider |