EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H37N5O7S3 |
| Net Charge | 0 |
| Average Mass | 639.822 |
| Monoisotopic Mass | 639.18551 |
| SMILES | COC(=O)[C@@H](CSC)N(C)C(=O)[C@H](CSC)N(C)C(=O)CNC(=O)[C@@H](CSC)NC(=O)c1nc2ccccc2cc1O |
| InChI | InChI=1S/C27H37N5O7S3/c1-31(19(14-41-5)26(37)32(2)20(15-42-6)27(38)39-3)22(34)12-28-24(35)18(13-40-4)30-25(36)23-21(33)11-16-9-7-8-10-17(16)29-23/h7-11,18-20,33H,12-15H2,1-6H3,(H,28,35)(H,30,36)/t18-,19+,20-/m1/s1 |
| InChIKey | FAHSFXZEUSTLEQ-HSALFYBXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Verrucosisporaspecies (ncbitaxon:1871626) | - | PubMed (21736356) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thiochondrilline B (CHEBI:204730) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| methyl (2S)-2-[[(2R)-2-[[2-[[(2S)-2-[(3-hydroxyquinoline-2-carbonyl)amino]-3-methylsulanylpropanoyl]amino]acetyl]-methylamino]-3-methylsulanylpropanoyl]-methylamino]-3-methylsulanylpropanoate |
| Manual Xrefs | Databases |
|---|---|
| 28185142 | ChemSpider |