EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20N4O5 |
| Net Charge | 0 |
| Average Mass | 300.315 |
| Monoisotopic Mass | 300.14337 |
| SMILES | CC(C)[C@H](NC(=O)[C@H](CN)NC(=O)/C=C/C(N)=O)C(=O)O |
| InChI | InChI=1S/C12H20N4O5/c1-6(2)10(12(20)21)16-11(19)7(5-13)15-9(18)4-3-8(14)17/h3-4,6-7,10H,5,13H2,1-2H3,(H2,14,17)(H,15,18)(H,16,19)(H,20,21)/b4-3+/t7-,10-/m0/s1 |
| InChIKey | IRWJJINNIZZEIB-BRUQVKLWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pantoea agglomerans (ncbitaxon:549) | - | PubMed (20041689) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dapdiamide D (CHEBI:204720) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S)-3-amino-2-[[(E)-4-amino-4-oxobut-2-enoyl]amino]propanoyl]amino]-3-methylbutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 58837248 | ChemSpider |