EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H36N2O8S2 |
| Net Charge | 0 |
| Average Mass | 628.769 |
| Monoisotopic Mass | 628.19131 |
| SMILES | CC=C(C)C(=O)[C@@H](C)[C@H](O)[C@@H](C)C(=O)O[C@H]1C=COC=C2C[C@@]3(SC)C(=O)N4c5c(O)cccc5C[C@@]4(SC)C(=O)N3[C@@H]21 |
| InChI | InChI=1S/C31H36N2O8S2/c1-7-16(2)25(35)17(3)26(36)18(4)27(37)41-22-11-12-40-15-20-14-31(43-6)28(38)32-23-19(9-8-10-21(23)34)13-30(32,42-5)29(39)33(31)24(20)22/h7-12,15,17-18,22,24,26,34,36H,13-14H2,1-6H3/t17-,18-,22+,24+,26+,30-,31-/m1/s1 |
| InChIKey | QRBLNDFKPJFNFP-IDYPZPIUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Scedosporium boydii (ncbitaxon:5597) | - | PubMed (25319640) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Boydine D (CHEBI:204678) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| [(1R,11R,14S,15S)-5-hydroxy-1,11-bis(methylsulanyl)-2,12-dioxo-18-oxa-3,13-diazapentacyclo[11.8.0.03,11.04,9.014,20]henicosa-4(9),5,7,16,19-pentaen-15-yl] (2R,3S,4S)-3-hydroxy-2,4,6-trimethyl-5-oxooct-6-enoate |