EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H44N4O6 |
| Net Charge | 0 |
| Average Mass | 496.649 |
| Monoisotopic Mass | 496.32609 |
| SMILES | CCCCCCC/C=C/C=C/C(=O)N[C@H](C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C25H44N4O6/c1-4-5-6-7-8-9-10-11-12-16-21(31)29-22(19(3)30)24(33)28-20(15-13-14-17-26)23(32)27-18(2)25(34)35/h10-12,16,18-20,22,30H,4-9,13-15,17,26H2,1-3H3,(H,27,32)(H,28,33)(H,29,31)(H,34,35)/b11-10+,16-12+/t18-,19+,20-,22-/m0/s1 |
| InChIKey | XQMCXKGPQLLQCI-PKOCWPOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Photorhabdus luminescens (ncbitaxon:29488) | - | PubMed (22909174) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Luminmycin C (CHEBI:204672) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S)-6-amino-2-[[(2S,3R)-2-[[(2E,4E)-dodeca-2,4-dienoyl]amino]-3-hydroxybutanoyl]amino]hexanoyl]amino]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78437176 | ChemSpider |