EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18O4 |
| Net Charge | 0 |
| Average Mass | 214.261 |
| Monoisotopic Mass | 214.12051 |
| SMILES | CC[C@H](O)[C@H]1C[C@H](C/C=C/C(=O)O)CO1 |
| InChI | InChI=1S/C11H18O4/c1-2-9(12)10-6-8(7-15-10)4-3-5-11(13)14/h3,5,8-10,12H,2,4,6-7H2,1H3,(H,13,14)/b5-3+/t8-,9-,10+/m0/s1 |
| InChIKey | JWXVXVPNKJNCSL-XLJKEWBWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Podospora communis (ncbitaxon:438773) | - | DOI (10.1016/j.tetlet.2004.07.093) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (5R,7S,8S)-Communiol B (CHEBI:204662) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| (E)-4-[(3S,5R)-5-[(1S)-1-hydroxypropyl]oxolan-3-yl]but-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9782954 | ChemSpider |