EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H27N2O3S |
| Net Charge | +1 |
| Average Mass | 399.536 |
| Monoisotopic Mass | 399.17369 |
| SMILES | C/C=C(C)/C=C/C=C/[C@H]1[C@@H]2C[C@@H]2c2c(SC[C@H](NC(C)=O)C(=O)O)ccc[n+]21 |
| InChI | InChI=1S/C22H26N2O3S/c1-4-14(2)8-5-6-9-19-16-12-17(16)21-20(10-7-11-24(19)21)28-13-18(22(26)27)23-15(3)25/h4-11,16-19H,12-13H2,1-3H3,(H-,23,25,26,27)/p+1/b8-5+,9-6+,14-4+/t16-,17+,18+,19+/m1/s1 |
| InChIKey | WAROMXVVDNYFEL-IKWXCPILSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | DOI (10.1016/j.tetlet.2016.06.040) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Iminimycin B (CHEBI:204635) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| (2R)-3-[[(1aR,2S,7bS)-2-[(1E,3E,5E)-5-methylhepta-1,3,5-trienyl]-1,1a,2,7b-tetrahydrocyclopropa[a]indolizin-3-ium-7-yl]sulanyl]-2-acetamidopropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78443817 | ChemSpider |