EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H12O5 |
| Net Charge | 0 |
| Average Mass | 308.289 |
| Monoisotopic Mass | 308.06847 |
| SMILES | C[C@]1(O)C=Cc2c(cc(O)c3c2C(=O)c2cccc(O)c2-3)C1=O |
| InChI | InChI=1S/C18H12O5/c1-18(23)6-5-8-10(17(18)22)7-12(20)15-13-9(16(21)14(8)15)3-2-4-11(13)19/h2-7,19-20,23H,1H3/t18-/m0/s1 |
| InChIKey | CKTLJJYDUPSLCZ-SFHVURJKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Micromonospora (ncbitaxon:1873) | - | PubMed (23136829) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fluostatin K (CHEBI:204595) is a fluorenes (CHEBI:24059) |
| IUPAC Name |
|---|
| (3S)-3,6,7-trihydroxy-3-methylbenzo[a]luorene-4,11-dione |
| Manual Xrefs | Databases |
|---|---|
| 28641173 | ChemSpider |