EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H54O9 |
| Net Charge | 0 |
| Average Mass | 582.775 |
| Monoisotopic Mass | 582.37678 |
| SMILES | CCC(C)CC(C)/C=C(\C=C(/C)C(O)C(C)/C=C(\C)C(O)C/C=C/C(O)C/C=C/C(O)CC(O)C(O)C(=O)O)CO |
| InChI | InChI=1S/C32H54O9/c1-7-20(2)14-21(3)15-25(19-33)17-24(6)30(38)23(5)16-22(4)28(36)13-9-11-26(34)10-8-12-27(35)18-29(37)31(39)32(40)41/h8-9,11-12,15-17,20-21,23,26-31,33-39H,7,10,13-14,18-19H2,1-6H3,(H,40,41)/b11-9+,12-8+,22-16+,24-17+,25-15+ |
| InChIKey | VTIWIBQZTPEOSH-ZQZRMASVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arthrinium phaeospermum (ncbitaxon:112178) | - | PubMed (18997391) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arthrinic acid (CHEBI:204559) is a very long-chain fatty acid (CHEBI:27283) |
| IUPAC Name |
|---|
| (6E,10E,14E,18E,20E)-2,3,5,9,13,17-hexahydroxy-20-(hydroxymethyl)-14,16,18,22,24-pentamethylhexacosa-6,10,14,18,20-pentaenoic acid |
| Manual Xrefs | Databases |
|---|---|
| 28285642 | ChemSpider |