EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H27NO8 |
| Net Charge | 0 |
| Average Mass | 457.479 |
| Monoisotopic Mass | 457.17367 |
| SMILES | C[C@@]1(CCC(=O)Nc2c(O)ccc(C(=O)O)c2O)C(=O)C=C[C@]23CC4C[C@H](O[C@@]4(CO)C2)C31 |
| InChI | InChI=1S/C24H27NO8/c1-22(6-5-17(29)25-18-14(27)3-2-13(19(18)30)21(31)32)16(28)4-7-23-9-12-8-15(20(22)23)33-24(12,10-23)11-26/h2-4,7,12,15,20,26-27,30H,5-6,8-11H2,1H3,(H,25,29)(H,31,32)/t12?,15-,20?,22+,23-,24+/m0/s1 |
| InChIKey | NNGABSPACJBNCJ-BXWYOIKBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (21214253) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Platensimycin A4 (CHEBI:204541) is a amidobenzoic acid (CHEBI:48470) |
| IUPAC Name |
|---|
| 2,4-dihydroxy-3-[3-[(1S,5S,7S,9S)-9-(hydroxymethyl)-5-methyl-4-oxo-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-en-5-yl]propanoylamino]benzoic acid |