EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9NO3 |
| Net Charge | 0 |
| Average Mass | 143.142 |
| Monoisotopic Mass | 143.05824 |
| SMILES | N[C@H](CC#CCO)C(=O)O |
| InChI | InChI=1S/C6H9NO3/c7-5(6(9)10)3-1-2-4-8/h5,8H,3-4,7H2,(H,9,10)/t5-/m1/s1 |
| InChIKey | HAPOKOYCNZZHNP-RXMQYKEDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Amanita miculifera (ncbitaxon:2303101) | - | DOI (10.1016/s0031-9422(98)00177-0) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R)-2-amino-6-hydroxy-4-hexynoic acid (CHEBI:204524) is a D-α-amino acid (CHEBI:16733) |
| IUPAC Name |
|---|
| (2R)-2-amino-6-hydroxyhex-4-ynoic acid |
| Manual Xrefs | Databases |
|---|---|
| 32973686 | ChemSpider |