EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20O7 |
| Net Charge | 0 |
| Average Mass | 360.362 |
| Monoisotopic Mass | 360.12090 |
| SMILES | CCC[C@H]1O[C@H](CC(=O)OC)[C@H](O)C2=C1C(=O)c1c(O)cccc1C2=O |
| InChI | InChI=1S/C19H20O7/c1-3-5-11-15-16(18(23)12(26-11)8-13(21)25-2)17(22)9-6-4-7-10(20)14(9)19(15)24/h4,6-7,11-12,18,20,23H,3,5,8H2,1-2H3/t11-,12-,18+/m1/s1 |
| InChIKey | NBXPOHABGLVLNR-FMTVUPSXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies (ncbitaxon:1931) | - | PubMed (11302493) |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl 2-[(1R,3R,4R)-4,9-dihydroxy-5,10-dioxo-1-propyl-3,4-dihydro-1H-benzo[g]isochromen-3-yl]acetate (CHEBI:204505) is a benzoisochromanequinone (CHEBI:48129) |
| IUPAC Name |
|---|
| methyl 2-[(1R,3R,4R)-4,9-dihydroxy-5,10-dioxo-1-propyl-3,4-dihydro-1H-benzo[g]isochromen-3-yl]acetate |
| Manual Xrefs | Databases |
|---|---|
| 7974733 | ChemSpider |