EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16O5 |
| Net Charge | 0 |
| Average Mass | 264.277 |
| Monoisotopic Mass | 264.09977 |
| SMILES | COc1cc(/C(C)=C/C(C)=C/C(=O)O)oc(=O)c1C |
| InChI | InChI=1S/C14H16O5/c1-8(6-13(15)16)5-9(2)11-7-12(18-4)10(3)14(17)19-11/h5-7H,1-4H3,(H,15,16)/b8-6+,9-5+ |
| InChIKey | PKDNRNGILXMLIA-RFSWUZDDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alternaria infectoria (ncbitaxon:45303) | - | DOI (10.1016/s0040-4039(03)01018-9) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Infectopyrone (CHEBI:204504) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,4E)-5-(4-methoxy-5-methyl-6-oxopyran-2-yl)-3-methylhexa-2,4-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9218801 | ChemSpider |