EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H41N7O7 |
| Net Charge | 0 |
| Average Mass | 611.700 |
| Monoisotopic Mass | 611.30675 |
| SMILES | CC(C)C(NC(=O)C(CCCN=C(N)N)NC(=O)NC(Cc1ccc(O)cc1)C(=O)O)C(=O)N[C@@H](C=O)Cc1ccccc1 |
| InChI | InChI=1S/C30H41N7O7/c1-18(2)25(27(41)34-21(17-38)15-19-7-4-3-5-8-19)37-26(40)23(9-6-14-33-29(31)32)35-30(44)36-24(28(42)43)16-20-10-12-22(39)13-11-20/h3-5,7-8,10-13,17-18,21,23-25,39H,6,9,14-16H2,1-2H3,(H,34,41)(H,37,40)(H,42,43)(H4,31,32,33)(H2,35,36,44)/t21-,23?,24?,25?/m1/s1 |
| InChIKey | DYNPEHYVIZVLIF-GRUCGOEVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (7775273) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GE20372 B (CHEBI:204482) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| 2-[[5-(diaminomethylideneamino)-1-[[3-methyl-1-oxo-1-[[(2R)-1-oxo-3-phenylpropan-2-yl]amino]butan-2-yl]amino]-1-oxopentan-2-yl]carbamoylamino]-3-(4-hydroxyphenyl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78445464 | ChemSpider |