EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H26O10 |
| Net Charge | 0 |
| Average Mass | 546.528 |
| Monoisotopic Mass | 546.15260 |
| SMILES | COc1c2c3c4c5c(c(=O)cc(OC)c5c5c(OC)cc(=O)c(c1O)c35)=C(O)[C@@]1(OC)O[C@@H](C)C[C@@]41[C@H]2C(C)=O |
| InChI | InChI=1S/C30H26O10/c1-10-9-29-24(11(2)31)23-22-20-16(26(34)27(23)38-5)12(32)7-14(36-3)18(20)19-15(37-4)8-13(33)17(21(19)25(22)29)28(35)30(29,39-6)40-10/h7-8,10,24,34-35H,9H2,1-6H3/t10-,24-,29+,30+/m0/s1 |
| InChIKey | AFOACYDTOFSVOR-UWSPMFCQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phaeosphaeriaspecies (ncbitaxon:1715242) | - | PubMed (22276650) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phaeosphaerin A (CHEBI:204468) is a phenanthrol (CHEBI:25962) |
| IUPAC Name |
|---|
| (1R,2S,21S,23S)-2-acetyl-5,20-dihydroxy-4,9,16,21-tetramethoxy-23-methyl-22-oxaheptacyclo[11.11.0.01,21.03,12.06,11.010,15.014,19]tetracosa-3(12),4,6(11),8,10(15),13,16,19-octaene-7,18-dione |
| Manual Xrefs | Databases |
|---|---|
| 78437145 | ChemSpider |