EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H34N4O3 |
| Net Charge | 0 |
| Average Mass | 426.561 |
| Monoisotopic Mass | 426.26309 |
| SMILES | CC(=O)NC(C(=O)N(C)C(CC(C)C)C(=O)N/C=C\c1cnc2ccccc12)C(C)C |
| InChI | InChI=1S/C24H34N4O3/c1-15(2)13-21(28(6)24(31)22(16(3)4)27-17(5)29)23(30)25-12-11-18-14-26-20-10-8-7-9-19(18)20/h7-12,14-16,21-22,26H,13H2,1-6H3,(H,25,30)(H,27,29)/b12-11- |
| InChIKey | IODNETMCEHQSGF-QXMHVHEDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillusspecies (ncbitaxon:5065) | - | PubMed (20531436) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| JBIR-81 (CHEBI:204455) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| 2-[(2-acetamido-3-methylbutanoyl)-methylamino]-N-[(Z)-2-(1H-indol-3-yl)ethenyl]-4-methylpentanamide |
| Manual Xrefs | Databases |
|---|---|
| 27024995 | ChemSpider |