EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12O6 |
| Net Charge | 0 |
| Average Mass | 252.222 |
| Monoisotopic Mass | 252.06339 |
| SMILES | COC(=O)c1ccc(O)c2c1[C@H](O)[C@@H](C)OC2=O |
| InChI | InChI=1S/C12H12O6/c1-5-10(14)8-6(11(15)17-2)3-4-7(13)9(8)12(16)18-5/h3-5,10,13-14H,1-2H3/t5-,10-/m1/s1 |
| InChIKey | OIKSASBCRUAAKC-GPXNAGAYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xylaria cubensis (ncbitaxon:114814) | - | DOI (10.1002/hlca.201400091) |
| Roles Classification |
|---|
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Akolitserin (CHEBI:204449) is a phthalate ester (CHEBI:35484) |
| IUPAC Name |
|---|
| methyl (3R,4S)-4,8-dihydroxy-3-methyl-1-oxo-3,4-dihydroisochromene-5-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 78440991 | ChemSpider |