EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H41N5O4 |
| Net Charge | 0 |
| Average Mass | 607.755 |
| Monoisotopic Mass | 607.31585 |
| SMILES | CCC(C)[C@H](NC(=O)[C@@H]1C=C2c3cccc4ncc(c34)C[C@H]2N(C)C1)C(=O)N1C(=O)[C@H]2CCCN2C(=O)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C36H41N5O4/c1-4-21(2)32(36(45)41-30(16-22-10-6-5-7-11-22)34(43)40-15-9-14-28(40)35(41)44)38-33(42)24-17-26-25-12-8-13-27-31(25)23(19-37-27)18-29(26)39(3)20-24/h5-8,10-13,17,19,21,24,28-30,32,37H,4,9,14-16,18,20H2,1-3H3,(H,38,42)/t21?,24-,28-,29-,30+,32+/m1/s1 |
| InChIKey | VIKMAEPJLMVSMP-KPLDYJOPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Claviceps purpurea (ncbitaxon:5111) | - | PubMed (18639312) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(lysergyl-isoleucyl)-cyclo(phenylalanyl-prolyl) (CHEBI:204395) is a alkaloid (CHEBI:22315) |
| IUPAC Name |
|---|
| (6aR,9R)-N-[(2S)-1-[(3S,8aR)-3-benzyl-1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-2-yl]-3-methyl-1-oxopentan-2-yl]-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-g]quinoline-9-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| 78437134 | ChemSpider |