EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H40N2O6 |
| Net Charge | 0 |
| Average Mass | 524.658 |
| Monoisotopic Mass | 524.28864 |
| SMILES | CO[C@H]([C@H](C)[C@H](/C=C/c1ccccc1)OC)[C@@H](C)/C=C/C(C)=C/C(=O)N/C=C\C/C=C\C(=O)NCC(=O)O |
| InChI | InChI=1S/C30H40N2O6/c1-22(20-28(34)31-19-11-7-10-14-27(33)32-21-29(35)36)15-16-23(2)30(38-5)24(3)26(37-4)18-17-25-12-8-6-9-13-25/h6,8-20,23-24,26,30H,7,21H2,1-5H3,(H,31,34)(H,32,33)(H,35,36)/b14-10-,16-15+,18-17+,19-11-,22-20+/t23-,24+,26-,30-/m0/s1 |
| InChIKey | KSYRCWWRVVIIEX-XUBYDZNKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chondromyces crocatus (ncbitaxon:52) | - | DOI (10.1002/(sici)1099-0690(199905)1999:5<1085::aid-ejoc1085>3.0.co;2-g) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Crocacin B (CHEBI:204269) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 2-[[(2Z,5Z)-6-[[(2E,4E,6S,7S,8R,9S,10E)-7,9-dimethoxy-3,6,8-trimethyl-11-phenylundeca-2,4,10-trienoyl]amino]hexa-2,5-dienoyl]amino]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 4977634 | ChemSpider |