EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H35N3O8 |
| Net Charge | 0 |
| Average Mass | 553.612 |
| Monoisotopic Mass | 553.24242 |
| SMILES | CC(=O)O[C@@H]1CC[C@@H]2C[C@H](C(N)=O)N(C(=O)[C@@H](Cc3ccc(O)cc3)NC(=O)[C@@H](O)Cc3ccc(O)cc3)[C@@H]2C1 |
| InChI | InChI=1S/C29H35N3O8/c1-16(33)40-22-11-6-19-14-25(27(30)37)32(24(19)15-22)29(39)23(12-17-2-7-20(34)8-3-17)31-28(38)26(36)13-18-4-9-21(35)10-5-18/h2-5,7-10,19,22-26,34-36H,6,11-15H2,1H3,(H2,30,37)(H,31,38)/t19-,22-,23-,24-,25-,26+/m1/s1 |
| InChIKey | BUDABURPHLLGEK-MKDQKPEESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Microcystis aeruginosa (ncbitaxon:1126) | - | PubMed (22280481) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aeruginosin GH553 (CHEBI:204263) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| [(2R,3aR,6R,7aR)-2-carbamoyl-1-[(2R)-2-[[(2S)-2-hydroxy-3-(4-hydroxyphenyl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindol-6-yl] acetate |
| Manual Xrefs | Databases |
|---|---|
| 28530098 | ChemSpider |