EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H16O4 |
| Net Charge | 0 |
| Average Mass | 392.410 |
| Monoisotopic Mass | 392.10486 |
| SMILES | O=C1C(=O)C(c2ccccc2)=c2c(-c3ccccc3)c(O)oc2=C1c1ccccc1 |
| InChI | InChI=1S/C26H16O4/c27-23-19(16-10-4-1-5-11-16)22-20(17-12-6-2-7-13-17)26(29)30-25(22)21(24(23)28)18-14-8-3-9-15-18/h1-15,29H |
| InChIKey | QYPJBISYXZLMLI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Peniophora (ncbitaxon:40463) | - | PubMed (9666186) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-Hydroxy-3,4,7-triphenyl-2,6-benzofurandione (CHEBI:204244) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| 2-hydroxy-3,4,7-triphenyl-1-benzouran-5,6-dione |
| Manual Xrefs | Databases |
|---|---|
| 8221587 | ChemSpider |