EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H7N3O3 |
| Net Charge | 0 |
| Average Mass | 181.151 |
| Monoisotopic Mass | 181.04874 |
| SMILES | NC(=O)/N=[N+](\[O-])c1ccc(O)cc1 |
| InChI | InChI=1S/C7H7N3O3/c8-7(12)9-10(13)5-1-3-6(11)4-2-5/h1-4,11H,(H2,8,12)/b10-9- |
| InChIKey | PQSCOCMQAQLWOJ-KTKRTIGZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Calvatia (ncbitaxon:68761) | - | DOI (10.1016/s0031-9422(97)00066-6) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxyphenyl-1-ONN-azoxyformamide (CHEBI:204233) is a tertiary amine (CHEBI:32876) |