EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9N3O |
| Net Charge | 0 |
| Average Mass | 139.158 |
| Monoisotopic Mass | 139.07456 |
| SMILES | N[C@H](C=O)Cc1cncn1 |
| InChI | InChI=1S/C6H9N3O/c7-5(3-10)1-6-2-8-4-9-6/h2-5H,1,7H2,(H,8,9)/t5-/m0/s1 |
| InChIKey | VYOIELONWKIZJS-YFKPBYRVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | DOI (10.1111/j.1399-3011.1995.tb00590.x) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BAY-o-6997 (CHEBI:204218) is a aralkylamine (CHEBI:18000) |
| IUPAC Name |
|---|
| 2-amino-3-(1H-imidazol-5-yl)propanal |
| Manual Xrefs | Databases |
|---|---|
| 754 | ChemSpider |