EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H20O3 |
| Net Charge | 0 |
| Average Mass | 224.300 |
| Monoisotopic Mass | 224.14124 |
| SMILES | C[C@@H]1C=C[C@@H]2C[C@H](CO)CC[C@H]2[C@@H]1C(=O)O |
| InChI | InChI=1S/C13H20O3/c1-8-2-4-10-6-9(7-14)3-5-11(10)12(8)13(15)16/h2,4,8-12,14H,3,5-7H2,1H3,(H,15,16)/t8-,9-,10-,11-,12-/m1/s1 |
| InChIKey | LQQYYLGWHXPFKQ-LZQZFOIKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apiospora montagnei (ncbitaxon:255776) | - | PubMed (15217297) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Apiosporic acid (CHEBI:204175) is a carboxylic acid (CHEBI:33575) |
| IUPAC Name |
|---|
| (1R,2R,4aS,6R,8aR)-6-(hydroxymethyl)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 9393419 | ChemSpider |