EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N2O4 |
| Net Charge | 0 |
| Average Mass | 224.216 |
| Monoisotopic Mass | 224.07971 |
| SMILES | COc1ccc(C(N)=O)c(O)c1NC(C)=O |
| InChI | InChI=1S/C10H12N2O4/c1-5(13)12-8-7(16-2)4-3-6(9(8)14)10(11)15/h3-4,14H,1-2H3,(H2,11,15)(H,12,13) |
| InChIKey | LQSKCSIAFZODHC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies DGC1 (ncbitaxon:1112742) | - | PubMed (23047245) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pyramidamycin D (CHEBI:204165) is a amidobenzoic acid (CHEBI:48470) |
| IUPAC Name |
|---|
| 3-acetamido-2-hydroxy-4-methoxybenzamide |
| Manual Xrefs | Databases |
|---|---|
| 29215412 | ChemSpider |