EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H44N6O9 |
| Net Charge | 0 |
| Average Mass | 608.693 |
| Monoisotopic Mass | 608.31698 |
| SMILES | CC(C)CCCCC[C@@H](N)CC(=O)N[C@H](CC(N)=O)C(=O)N[C@H](C(=O)N[C@@H](C(=O)O)[C@@H](O)c1ccccc1)[C@@H](O)C(N)=O |
| InChI | InChI=1S/C28H44N6O9/c1-15(2)9-5-3-8-12-17(29)13-20(36)32-18(14-19(30)35)26(40)33-21(24(38)25(31)39)27(41)34-22(28(42)43)23(37)16-10-6-4-7-11-16/h4,6-7,10-11,15,17-18,21-24,37-38H,3,5,8-9,12-14,29H2,1-2H3,(H2,30,35)(H2,31,39)(H,32,36)(H,33,40)(H,34,41)(H,42,43)/t17-,18-,21+,22-,23+,24-/m1/s1 |
| InChIKey | JENXRARIASYFRK-LXTLSNALSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cystobacter (ncbitaxon:42) | - | PubMed (24735013) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cystomanamide A (CHEBI:204157) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2R,3S)-2-[[(2S,3R)-4-amino-2-[[(2R)-4-amino-2-[[(3R)-3-amino-9-methyldecanoyl]amino]-4-oxobutanoyl]amino]-3-hydroxy-4-oxobutanoyl]amino]-3-hydroxy-3-phenylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 58825836 | ChemSpider |