EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H56N4O9 |
| Net Charge | 0 |
| Average Mass | 688.863 |
| Monoisotopic Mass | 688.40473 |
| SMILES | CCCC1NC(=O)CNC(=O)[C@@H](Cc2ccc(OC)cc2)N(C)C(=O)[C@H](C(C)C)OC(=O)[C@H](C(C)C)N(C)C(=O)[C@H](C(C)C)OC(=O)C1C |
| InChI | InChI=1S/C36H56N4O9/c1-12-13-26-23(8)35(45)48-31(22(6)7)34(44)40(10)29(20(2)3)36(46)49-30(21(4)5)33(43)39(9)27(32(42)37-19-28(41)38-26)18-24-14-16-25(47-11)17-15-24/h14-17,20-23,26-27,29-31H,12-13,18-19H2,1-11H3,(H,37,42)(H,38,41)/t23?,26?,27-,29+,30+,31+/m1/s1 |
| InChIKey | UFZHQKNOTHZBQG-WRCAOINYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lyngbya majuscula (ncbitaxon:158786) | - | PubMed (12828459) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Guineamide D (CHEBI:204124) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (2S,5S,8S,11R)-11-[(4-methoxyphenyl)methyl]-4,10,18-trimethyl-2,5,8-tri(propan-2-yl)-17-propyl-1,7-dioxa-4,10,13,16-tetrazacyclononadecane-3,6,9,12,15,19-hexone |
| Manual Xrefs | Databases |
|---|---|
| 10140868 | ChemSpider |