EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H48O5 |
| Net Charge | 0 |
| Average Mass | 500.720 |
| Monoisotopic Mass | 500.35017 |
| SMILES | C[C@@H]1C[C@]2(OC[C@@]34[C@@H]1CC[C@@]3(C)C1=C(C[C@@H]4O)[C@@]3(C)CC[C@@H](O)C(C)(C)[C@@H]3CC1)OC(=O)[C@@H](C)[C@@H]2C |
| InChI | InChI=1S/C31H48O5/c1-17-15-31(19(3)18(2)26(34)36-31)35-16-30-20(17)10-13-29(30,7)21-8-9-23-27(4,5)24(32)11-12-28(23,6)22(21)14-25(30)33/h17-20,23-25,32-33H,8-16H2,1-7H3/t17-,18+,19+,20-,23+,24-,25+,28-,29+,30+,31+/m1/s1 |
| InChIKey | KZYMUMWRDHVBQQ-QQOUVJANSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fomes (ncbitaxon:40441) | - | PubMed (19182411) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fomefficinol A (CHEBI:204099) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| (1R,2S,3'S,4'S,5S,8R,10R,14S,17R,18R,20S)-2,8-dihydroxy-3',4',5,9,9,14,18-heptamethylspiro[21-oxapentacyclo[12.8.0.01,17.04,13.05,10]docos-4(13)-ene-20,5'-oxolane]-2'-one |
| Manual Xrefs | Databases |
|---|---|
| 78437093 | ChemSpider |