EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H10O6 |
| Net Charge | 0 |
| Average Mass | 238.195 |
| Monoisotopic Mass | 238.04774 |
| SMILES | COc1c(C)cc(C(=O)O)c2c1C(=O)O[C@@H]2O |
| InChI | InChI=1S/C11H10O6/c1-4-3-5(9(12)13)6-7(8(4)16-2)11(15)17-10(6)14/h3,10,14H,1-2H3,(H,12,13)/t10-/m0/s1 |
| InChIKey | NMTBHJJZDBPWDC-JTQLQIEISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phomopsis (ncbitaxon:34399) | - | DOI (10.1139/v92-286) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Convolvulanic acid A (CHEBI:204069) is a 2-hydroxyisophthalic acid (CHEBI:19643) |
| IUPAC Name |
|---|
| 3-hydroxy-7-methoxy-6-methyl-1-oxo-3H-2-benzouran-4-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 155506 | ChemSpider |