EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H39N3O5 |
| Net Charge | 0 |
| Average Mass | 473.614 |
| Monoisotopic Mass | 473.28897 |
| SMILES | CCCCC(C)C1CC(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@@H](C)C(=O)N[C@H](C(C)C)C(=O)O1 |
| InChI | InChI=1S/C26H39N3O5/c1-6-7-11-17(4)21-15-22(30)28-20(14-19-12-9-8-10-13-19)25(32)27-18(5)24(31)29-23(16(2)3)26(33)34-21/h8-10,12-13,16-18,20-21,23H,6-7,11,14-15H2,1-5H3,(H,27,32)(H,28,30)(H,29,31)/t17?,18-,20-,21?,23+/m0/s1 |
| InChIKey | OVLSBHCZQRFSPZ-VJZUKPHFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Beauveria (ncbitaxon:5581) | - | PubMed (15032479) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Beauveriolide VII (CHEBI:204063) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (3R,6S,9S)-9-benzyl-13-hexan-2-yl-6-methyl-3-propan-2-yl-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 8132126 | ChemSpider |