EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H14O4 |
| Net Charge | 0 |
| Average Mass | 234.251 |
| Monoisotopic Mass | 234.08921 |
| SMILES | CC(C)=CCc1c(O)cc2c(c1O)C(=O)OC2 |
| InChI | InChI=1S/C13H14O4/c1-7(2)3-4-9-10(14)5-8-6-17-13(16)11(8)12(9)15/h3,5,14-15H,4,6H2,1-2H3 |
| InChIKey | OBCQCAJREYSTRK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stereum (ncbitaxon:5644) | - | PubMed (17193259) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,7-dihydroxy-6-(3-methylbut-2-enyl)isobenzofuran-1(3H)-one (CHEBI:204059) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-6-(3-methylbut-2-enyl)-3H-2-benzouran-1-one |
| Manual Xrefs | Databases |
|---|---|
| 78435629 | ChemSpider |