EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H34N4O6 |
| Net Charge | 0 |
| Average Mass | 438.525 |
| Monoisotopic Mass | 438.24783 |
| SMILES | C[C@H](O)C(=O)CCCCC[C@@H]1NC(=O)[C@@H](C)NC(=O)[C@H](C)NC(=O)[C@H]2CCCN2C1=O |
| InChI | InChI=1S/C21H34N4O6/c1-12-18(28)22-13(2)19(29)24-15(8-5-4-6-10-17(27)14(3)26)21(31)25-11-7-9-16(25)20(30)23-12/h12-16,26H,4-11H2,1-3H3,(H,22,28)(H,23,30)(H,24,29)/t12-,13+,14-,15-,16+/m0/s1 |
| InChIKey | LITDOSAZPRIJRA-XFIYOXNOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusariumspecies (ncbitaxon:29916) | - | DOI (10.1016/s0031-9422(02)00061-4) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| JM47 (CHEBI:204033) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (3S,6R,9S,12R)-3-[(7S)-7-hydroxy-6-oxooctyl]-6,9-dimethyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 9114293 | ChemSpider |