EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H33N7O |
| Net Charge | 0 |
| Average Mass | 327.477 |
| Monoisotopic Mass | 327.27466 |
| SMILES | NC(N)=NCCCCCCCCC(=O)[C@@H](N)CCCN=C(N)N |
| InChI | InChI=1S/C15H33N7O/c16-12(8-7-11-22-15(19)20)13(23)9-5-3-1-2-4-6-10-21-14(17)18/h12H,1-11,16H2,(H4,17,18,21)(H4,19,20,22)/t12-/m0/s1 |
| InChIKey | YLKMPCDZOHNNJU-LBPRGKRZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | DOI (10.1021/np50120a004) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Muscarinic receptor antagonist 1 (CHEBI:204022) is a ketone (CHEBI:17087) |
| Muscarinic receptor antagonist 1 (CHEBI:204022) is a organic amino compound (CHEBI:50047) |
| IUPAC Name |
|---|
| 2-[4-amino-13-(diaminomethylideneamino)-5-oxotridecyl]guanidine |
| Manual Xrefs | Databases |
|---|---|
| 24698816 | ChemSpider |