EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H18O6 |
| Net Charge | 0 |
| Average Mass | 378.380 |
| Monoisotopic Mass | 378.11034 |
| SMILES | O=C1C[C@H](c2ccc(O)cc2)Oc2cc(O)c(Cc3ccccc3O)c(O)c21 |
| InChI | InChI=1S/C22H18O6/c23-14-7-5-12(6-8-14)19-11-18(26)21-20(28-19)10-17(25)15(22(21)27)9-13-3-1-2-4-16(13)24/h1-8,10,19,23-25,27H,9,11H2/t19-/m1/s1 |
| InChIKey | OEPZGPZSYKMOSV-LJQANCHMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sanghuangporus baumii (ncbitaxon:108892) | - | DOI (10.5281/zenodo.3541232) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Epi-phelligrin A (CHEBI:203976) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| (2R)-5,7-dihydroxy-2-(4-hydroxyphenyl)-6-[(2-hydroxyphenyl)methyl]-2,3-dihydrochromen-4-one |
| Manual Xrefs | Databases |
|---|---|
| 26336923 | ChemSpider |