EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10N2O4 |
| Net Charge | 0 |
| Average Mass | 222.200 |
| Monoisotopic Mass | 222.06406 |
| SMILES | CC(=Nc1ccccc1C(=O)O)NC(=O)O |
| InChI | InChI=1S/C10H10N2O4/c1-6(12-10(15)16)11-8-5-3-2-4-7(8)9(13)14/h2-5H,1H3,(H,11,12)(H,13,14)(H,15,16) |
| InChIKey | MJKHMRCNKUTVLN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (23966037) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Penipacid C (CHEBI:203935) is a benzoic acids (CHEBI:22723) |
| IUPAC Name |
|---|
| 2-[1-(carboxyamino)ethylideneamino]benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 30771323 | ChemSpider |