EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24Cl2N2O2S |
| Net Charge | 0 |
| Average Mass | 427.397 |
| Monoisotopic Mass | 426.09355 |
| SMILES | CO/C(=C/C(=O)N(C)C(Cc1ccccc1)c1nccs1)C[C@H](C)C(Cl)Cl |
| InChI | InChI=1S/C20H24Cl2N2O2S/c1-14(19(21)22)11-16(26-3)13-18(25)24(2)17(20-23-9-10-27-20)12-15-7-5-4-6-8-15/h4-10,13-14,17,19H,11-12H2,1-3H3/b16-13+/t14-,17?/m0/s1 |
| InChIKey | AOEGCPSVMLZAOC-FSJNOBNXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cyanobacterium (ncbitaxon:102234) | - | DOI (10.1016/s0040-4020(00)00763-8) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dechlorobarbamide (CHEBI:203914) is a amphetamines (CHEBI:35338) |
| IUPAC Name |
|---|
| (E,5S)-6,6-dichloro-3-methoxy-N,5-dimethyl-N-[2-phenyl-1-(1,3-thiazol-2-yl)ethyl]hex-2-enamide |
| Manual Xrefs | Databases |
|---|---|
| 78440178 | ChemSpider |