EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14N2O3 |
| Net Charge | 0 |
| Average Mass | 162.189 |
| Monoisotopic Mass | 162.10044 |
| SMILES | NCCC(O)C[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H14N2O3/c7-2-1-4(9)3-5(8)6(10)11/h4-5,9H,1-3,7-8H2,(H,10,11)/t4?,5-/m0/s1 |
| InChIKey | ASYBZHICIMVQII-AKGZTFGVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxy-L-lysine (CHEBI:20391) is a 4-hydroxylysine (CHEBI:86273) |
| 4-hydroxy-L-lysine (CHEBI:20391) is a hydroxy-L-lysine (CHEBI:24661) |
| 4-hydroxy-L-lysine (CHEBI:20391) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| 4-hydroxy-L-lysine (CHEBI:20391) is conjugate base of 4-hydroxy-L-lysine(1+) (CHEBI:141496) |
| Incoming Relation(s) |
| (4R)-4-hydroxy-L-lysine (CHEBI:77483) is a 4-hydroxy-L-lysine (CHEBI:20391) |
| 4-hydroxy-L-lysine(1+) (CHEBI:141496) is conjugate acid of 4-hydroxy-L-lysine (CHEBI:20391) |