EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H48N4O7 |
| Net Charge | 0 |
| Average Mass | 540.702 |
| Monoisotopic Mass | 540.35230 |
| SMILES | CCCCCCC/C=C/C=C/C(=O)N[C@H](C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(O)CC(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C27H48N4O7/c1-4-5-6-7-8-9-10-11-12-16-23(34)31-25(20(3)32)27(38)30-21(15-13-14-17-28)26(37)29-19(2)22(33)18-24(35)36/h10-12,16,19-22,25,32-33H,4-9,13-15,17-18,28H2,1-3H3,(H,29,37)(H,30,38)(H,31,34)(H,35,36)/b11-10+,16-12+/t19-,20+,21-,22?,25-/m0/s1 |
| InChIKey | JRFQUOXEKACVEL-AVHFMUBGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Photorhabdus luminescens (ncbitaxon:29488) | - | PubMed (22909174) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Luminmycin B (CHEBI:203902) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (4S)-4-[[(2S)-6-amino-2-[[(2S,3R)-2-[[(2E,4E)-dodeca-2,4-dienoyl]amino]-3-hydroxybutanoyl]amino]hexanoyl]amino]-3-hydroxypentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 28533845 | ChemSpider |